C22H20N6O2S — CID 6044882
N-[(Z)-(4-cyanophenyl)methylideneamino]-3-[3-[(2Z)-2-[(4-cyanophenyl)methylidene]hydrazinyl]-3-oxopropyl]sulfanylpropanamide (PubChem CID 6044882) has the molecular formula C22H20N6O2S and a molecular weight of 432.51 g/mol. Its IUPAC name is N-[(Z)-(4-cyanophenyl)methylideneamino]-3-[3-[(2Z)-2-[(4-cyanophenyl)methylidene]hydrazinyl]-3-oxopropyl]sulfanylpropanamide.
| Compound Name | N-[(Z)-(4-cyanophenyl)methylideneamino]-3-[3-[(2Z)-2-[(4-cyanophenyl)methylidene]hydrazinyl]-3-oxopropyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 6044882 |
| Molecular Formula | C22H20N6O2S |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | N-[(Z)-(4-cyanophenyl)methylideneamino]-3-[3-[(2Z)-2-[(4-cyanophenyl)methylidene]hydrazinyl]-3-oxopropyl]sulfanylpropanamide |
| SMILES | N#Cc1ccc(/C=N\NC(=O)CCSCCC(=O)N/N=C\c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C22H20N6O2S/c23-13-17-1-5-19(6-2-17)15-25-27-21(29)9-11-31-12-10-22(30)28-26-16-20-7-3-18(14-24)4-8-20/h1-8,15-16H,9-12H2,(H,27,29)(H,28,30)/b25-15-,26-16- |
| InChIKey | BWNNAWSSCIYJBW-YXHOTNNGSA-N |
| XLogP | 2.54 |
| TPSA | 130.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|