C19H11N3OS — CID 6046219
(E)-2-[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-3-pyridin-3-ylprop-2-enenitrile (PubChem CID 6046219) has the molecular formula C19H11N3OS and a molecular weight of 329.38 g/mol. Its IUPAC name is (E)-2-[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-3-pyridin-3-ylprop-2-enenitrile.
| Compound Name | (E)-2-[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-3-pyridin-3-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 6046219 |
| Molecular Formula | C19H11N3OS |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | (E)-2-[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-3-pyridin-3-ylprop-2-enenitrile |
| SMILES | N#C/C(=C\c1cccnc1)c1nc(-c2cc3ccccc3o2)cs1 |
| InChI | InChI=1S/C19H11N3OS/c20-10-15(8-13-4-3-7-21-11-13)19-22-16(12-24-19)18-9-14-5-1-2-6-17(14)23-18/h1-9,11-12H/b15-8+ |
| InChIKey | JSUHUMPYHHSBER-OVCLIPMQSA-N |
| XLogP | 5.02 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|