C25H27FN4O3 — CID 6049689
(E)-[1-[3-(dimethylazaniumyl)propyl]-2-(4-fluorophenyl)-4,5-dioxopyrrolidin-3-ylidene]-(2,8-dimethylimidazo[1,2-a]pyridin-3-yl)methanolate (PubChem CID 6049689) has the molecular formula C25H27FN4O3 and a molecular weight of 450.51 g/mol. Its IUPAC name is (E)-[1-[3-(dimethylazaniumyl)propyl]-2-(4-fluorophenyl)-4,5-dioxopyrrolidin-3-ylidene]-(2,8-dimethylimidazo[1,2-a]pyridin-3-yl)methanolate.
| Compound Name | (E)-[1-[3-(dimethylazaniumyl)propyl]-2-(4-fluorophenyl)-4,5-dioxopyrrolidin-3-ylidene]-(2,8-dimethylimidazo[1,2-a]pyridin-3-yl)methanolate |
|---|---|
| PubChem CID | 6049689 |
| Molecular Formula | C25H27FN4O3 |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | (E)-[1-[3-(dimethylazaniumyl)propyl]-2-(4-fluorophenyl)-4,5-dioxopyrrolidin-3-ylidene]-(2,8-dimethylimidazo[1,2-a]pyridin-3-yl)methanolate |
| SMILES | Cc1nc2c(C)cccn2c1/C([O-])=C1\C(=O)C(=O)N(CCC[NH+](C)C)C1c1ccc(F)cc1 |
| InChI | InChI=1S/C25H27FN4O3/c1-15-7-5-13-29-20(16(2)27-24(15)29)22(31)19-21(17-8-10-18(26)11-9-17)30(25(33)23(19)32)14-6-12-28(3)4/h5,7-11,13,21,31H,6,12,14H2,1-4H3/b22-19+ |
| InChIKey | RABAISPRACZYMV-ZBJSNUHESA-N |
| XLogP | 0.85 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|