C19H22F2N4O3S — CID 60500673
N-(2,5-difluorophenyl)-2-[4-(4-sulfamoylphenyl)piperazin-1-yl]propanamide (PubChem CID 60500673) has the molecular formula C19H22F2N4O3S and a molecular weight of 424.47 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-2-[4-(4-sulfamoylphenyl)piperazin-1-yl]propanamide.
| Compound Name | N-(2,5-difluorophenyl)-2-[4-(4-sulfamoylphenyl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 60500673 |
| Molecular Formula | C19H22F2N4O3S |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | N-(2,5-difluorophenyl)-2-[4-(4-sulfamoylphenyl)piperazin-1-yl]propanamide |
| SMILES | CC(C(=O)Nc1cc(F)ccc1F)N1CCN(c2ccc(S(N)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C19H22F2N4O3S/c1-13(19(26)23-18-12-14(20)2-7-17(18)21)24-8-10-25(11-9-24)15-3-5-16(6-4-15)29(22,27)28/h2-7,12-13H,8-11H2,1H3,(H,23,26)(H2,22,27,28) |
| InChIKey | ZPRAGMXIWGWMJQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |