C21H25Cl2N3O3S — CID 60501288
2-(4-benzylsulfonylpiperazin-1-yl)-N-[2-(2,3-dichlorophenyl)ethyl]acetamide (PubChem CID 60501288) has the molecular formula C21H25Cl2N3O3S and a molecular weight of 470.42 g/mol. Its IUPAC name is 2-(4-benzylsulfonylpiperazin-1-yl)-N-[2-(2,3-dichlorophenyl)ethyl]acetamide.
| Compound Name | 2-(4-benzylsulfonylpiperazin-1-yl)-N-[2-(2,3-dichlorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 60501288 |
| Molecular Formula | C21H25Cl2N3O3S |
| Molecular Weight | 470.42 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | 2-(4-benzylsulfonylpiperazin-1-yl)-N-[2-(2,3-dichlorophenyl)ethyl]acetamide |
| SMILES | O=C(CN1CCN(S(=O)(=O)Cc2ccccc2)CC1)NCCc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C21H25Cl2N3O3S/c22-19-8-4-7-18(21(19)23)9-10-24-20(27)15-25-11-13-26(14-12-25)30(28,29)16-17-5-2-1-3-6-17/h1-8H,9-16H2,(H,24,27) |
| InChIKey | KPCDWCMYXNBWQZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |