C18H27ClN2O4S — CID 60507014
2-[3-(3-chlorophenoxy)propyl-methylamino]-N-(1,1-dioxothiolan-3-yl)-N-ethylacetamide (PubChem CID 60507014) has the molecular formula C18H27ClN2O4S and a molecular weight of 402.94 g/mol. Its IUPAC name is 2-[3-(3-chlorophenoxy)propyl-methylamino]-N-(1,1-dioxothiolan-3-yl)-N-ethylacetamide.
| Compound Name | 2-[3-(3-chlorophenoxy)propyl-methylamino]-N-(1,1-dioxothiolan-3-yl)-N-ethylacetamide |
|---|---|
| PubChem CID | 60507014 |
| Molecular Formula | C18H27ClN2O4S |
| Molecular Weight | 402.94 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 2-[3-(3-chlorophenoxy)propyl-methylamino]-N-(1,1-dioxothiolan-3-yl)-N-ethylacetamide |
| SMILES | CCN(C(=O)CN(C)CCCOc1cccc(Cl)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H27ClN2O4S/c1-3-21(16-8-11-26(23,24)14-16)18(22)13-20(2)9-5-10-25-17-7-4-6-15(19)12-17/h4,6-7,12,16H,3,5,8-11,13-14H2,1-2H3 |
| InChIKey | LTSIZGVMSBLRRZ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.94 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|