C19H29BrN2O — CID 60508198
5-(4-bromophenyl)-N-(1-piperidin-1-ylpropan-2-yl)pentanamide (PubChem CID 60508198) has the molecular formula C19H29BrN2O and a molecular weight of 381.36 g/mol. Its IUPAC name is 5-(4-bromophenyl)-N-(1-piperidin-1-ylpropan-2-yl)pentanamide.
| Compound Name | 5-(4-bromophenyl)-N-(1-piperidin-1-ylpropan-2-yl)pentanamide |
|---|---|
| PubChem CID | 60508198 |
| Molecular Formula | C19H29BrN2O |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 5-(4-bromophenyl)-N-(1-piperidin-1-ylpropan-2-yl)pentanamide |
| SMILES | CC(CN1CCCCC1)NC(=O)CCCCc1ccc(Br)cc1 |
| InChI | InChI=1S/C19H29BrN2O/c1-16(15-22-13-5-2-6-14-22)21-19(23)8-4-3-7-17-9-11-18(20)12-10-17/h9-12,16H,2-8,13-15H2,1H3,(H,21,23) |
| InChIKey | LEEZPRZNHSRRCB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|