C15H15N3O6S — CID 6051167
2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-[(Z)-furan-2-ylmethylideneamino]acetamide (PubChem CID 6051167) has the molecular formula C15H15N3O6S and a molecular weight of 365.37 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-[(Z)-furan-2-ylmethylideneamino]acetamide.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-[(Z)-furan-2-ylmethylideneamino]acetamide |
|---|---|
| PubChem CID | 6051167 |
| Molecular Formula | C15H15N3O6S |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-[(Z)-furan-2-ylmethylideneamino]acetamide |
| SMILES | O=C(CNS(=O)(=O)c1ccc2c(c1)OCCO2)N/N=C\c1ccco1 |
| InChI | InChI=1S/C15H15N3O6S/c19-15(18-16-9-11-2-1-5-22-11)10-17-25(20,21)12-3-4-13-14(8-12)24-7-6-23-13/h1-5,8-9,17H,6-7,10H2,(H,18,19)/b16-9- |
| InChIKey | DQSHKDXSZSRBBV-SXGWCWSVSA-N |
| XLogP | 0.48 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|