C17H15Cl2NO3S — CID 60513452
N-[4-[2-(3,5-dichlorophenoxy)acetyl]-2-methylsulfanylphenyl]acetamide (PubChem CID 60513452) has the molecular formula C17H15Cl2NO3S and a molecular weight of 384.28 g/mol. Its IUPAC name is N-[4-[2-(3,5-dichlorophenoxy)acetyl]-2-methylsulfanylphenyl]acetamide.
| Compound Name | N-[4-[2-(3,5-dichlorophenoxy)acetyl]-2-methylsulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 60513452 |
| Molecular Formula | C17H15Cl2NO3S |
| Molecular Weight | 384.28 g/mol |
| Exact Mass | 383.01 |
| IUPAC Name | N-[4-[2-(3,5-dichlorophenoxy)acetyl]-2-methylsulfanylphenyl]acetamide |
| SMILES | CSc1cc(C(=O)COc2cc(Cl)cc(Cl)c2)ccc1NC(C)=O |
| InChI | InChI=1S/C17H15Cl2NO3S/c1-10(21)20-15-4-3-11(5-17(15)24-2)16(22)9-23-14-7-12(18)6-13(19)8-14/h3-8H,9H2,1-2H3,(H,20,21) |
| InChIKey | STUFTIUMQAEXKJ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.28 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |