C18H15FN2O5 — CID 60518431
7-fluoro-6-[2-(2-methyl-3-nitrophenoxy)acetyl]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 60518431) has the molecular formula C18H15FN2O5 and a molecular weight of 358.33 g/mol. Its IUPAC name is 7-fluoro-6-[2-(2-methyl-3-nitrophenoxy)acetyl]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7-fluoro-6-[2-(2-methyl-3-nitrophenoxy)acetyl]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 60518431 |
| Molecular Formula | C18H15FN2O5 |
| Molecular Weight | 358.33 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 7-fluoro-6-[2-(2-methyl-3-nitrophenoxy)acetyl]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | Cc1c(OCC(=O)c2cc3c(cc2F)NC(=O)CC3)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H15FN2O5/c1-10-15(21(24)25)3-2-4-17(10)26-9-16(22)12-7-11-5-6-18(23)20-14(11)8-13(12)19/h2-4,7-8H,5-6,9H2,1H3,(H,20,23) |
| InChIKey | XBBVMTWINXYBFS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|