C17H14FN3O4 — CID 91649819
N-(7-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)-2-(3-nitrophenyl)acetamide (PubChem CID 91649819) has the molecular formula C17H14FN3O4 and a molecular weight of 343.31 g/mol. Its IUPAC name is N-(7-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)-2-(3-nitrophenyl)acetamide.
| Compound Name | N-(7-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)-2-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 91649819 |
| Molecular Formula | C17H14FN3O4 |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | N-(7-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)-2-(3-nitrophenyl)acetamide |
| SMILES | O=C(Cc1cccc([N+](=O)[O-])c1)Nc1cc2c(cc1F)NC(=O)CC2 |
| InChI | InChI=1S/C17H14FN3O4/c18-13-9-14-11(4-5-16(22)19-14)8-15(13)20-17(23)7-10-2-1-3-12(6-10)21(24)25/h1-3,6,8-9H,4-5,7H2,(H,19,22)(H,20,23) |
| InChIKey | LFMAKCWUGFTISH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|