C23H23F3N4O2S — CID 60519647
N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-2-[1-(4-propan-2-ylphenyl)imidazol-2-yl]sulfanylpropanamide (PubChem CID 60519647) has the molecular formula C23H23F3N4O2S and a molecular weight of 476.52 g/mol. Its IUPAC name is N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-2-[1-(4-propan-2-ylphenyl)imidazol-2-yl]sulfanylpropanamide.
| Compound Name | N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-2-[1-(4-propan-2-ylphenyl)imidazol-2-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 60519647 |
| Molecular Formula | C23H23F3N4O2S |
| Molecular Weight | 476.52 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-2-[1-(4-propan-2-ylphenyl)imidazol-2-yl]sulfanylpropanamide |
| SMILES | CC(Sc1nccn1-c1ccc(C(C)C)cc1)C(=O)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C23H23F3N4O2S/c1-13(2)15-4-6-16(7-5-15)30-11-10-27-23(30)33-14(3)22(32)28-12-19(31)29-18-9-8-17(24)20(25)21(18)26/h4-11,13-14H,12H2,1-3H3,(H,28,32)(H,29,31) |
| InChIKey | SRYWFPNSODPODP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|