C13H14N6O2 — CID 60520977
N-[2-[(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]ethyl]furan-2-carboxamide (PubChem CID 60520977) has the molecular formula C13H14N6O2 and a molecular weight of 286.29 g/mol. Its IUPAC name is N-[2-[(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 60520977 |
| Molecular Formula | C13H14N6O2 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | N-[2-[(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]ethyl]furan-2-carboxamide |
| SMILES | Cc1nnc2ccc(NCCNC(=O)c3ccco3)nn12 |
| InChI | InChI=1S/C13H14N6O2/c1-9-16-17-12-5-4-11(18-19(9)12)14-6-7-15-13(20)10-3-2-8-21-10/h2-5,8H,6-7H2,1H3,(H,14,18)(H,15,20) |
| InChIKey | SXLGUBCSEOTPGV-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|