C25H20N4O4 — CID 60527561
ethyl 4-[(Z)-2-cyano-3-(5-methoxy-1H-indol-3-yl)-3-oxoprop-1-enyl]-1-phenylpyrazole-3-carboxylate (PubChem CID 60527561) has the molecular formula C25H20N4O4 and a molecular weight of 440.46 g/mol. Its IUPAC name is ethyl 4-[(Z)-2-cyano-3-(5-methoxy-1H-indol-3-yl)-3-oxoprop-1-enyl]-1-phenylpyrazole-3-carboxylate.
| Compound Name | ethyl 4-[(Z)-2-cyano-3-(5-methoxy-1H-indol-3-yl)-3-oxoprop-1-enyl]-1-phenylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 60527561 |
| Molecular Formula | C25H20N4O4 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | ethyl 4-[(Z)-2-cyano-3-(5-methoxy-1H-indol-3-yl)-3-oxoprop-1-enyl]-1-phenylpyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccccc2)cc1/C=C(/C#N)C(=O)c1c[nH]c2ccc(OC)cc12 |
| InChI | InChI=1S/C25H20N4O4/c1-3-33-25(31)23-17(15-29(28-23)18-7-5-4-6-8-18)11-16(13-26)24(30)21-14-27-22-10-9-19(32-2)12-20(21)22/h4-12,14-15,27H,3H2,1-2H3/b16-11- |
| InChIKey | QVIHAWZGIMEUNT-WJDWOHSUSA-N |
| XLogP | 4.33 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|