C17H19FO2S — CID 60531283
1-[1-(4-fluorophenyl)ethylsulfonylmethyl]-3,5-dimethylbenzene (PubChem CID 60531283) has the molecular formula C17H19FO2S and a molecular weight of 306.40 g/mol. Its IUPAC name is 1-[1-(4-fluorophenyl)ethylsulfonylmethyl]-3,5-dimethylbenzene.
| Compound Name | 1-[1-(4-fluorophenyl)ethylsulfonylmethyl]-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 60531283 |
| Molecular Formula | C17H19FO2S |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 1-[1-(4-fluorophenyl)ethylsulfonylmethyl]-3,5-dimethylbenzene |
| SMILES | Cc1cc(C)cc(CS(=O)(=O)C(C)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C17H19FO2S/c1-12-8-13(2)10-15(9-12)11-21(19,20)14(3)16-4-6-17(18)7-5-16/h4-10,14H,11H2,1-3H3 |
| InChIKey | FQYTWUDLHYEKFB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |