C23H21N3O3S2 — CID 60532491
N-[[6-(2-phenoxyethoxy)-3-pyridinyl]methyl]-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide (PubChem CID 60532491) has the molecular formula C23H21N3O3S2 and a molecular weight of 451.57 g/mol. Its IUPAC name is N-[[6-(2-phenoxyethoxy)-3-pyridinyl]methyl]-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-[[6-(2-phenoxyethoxy)-3-pyridinyl]methyl]-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 60532491 |
| Molecular Formula | C23H21N3O3S2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | N-[[6-(2-phenoxyethoxy)-3-pyridinyl]methyl]-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide |
| SMILES | O=C(Cc1csc(-c2cccs2)n1)NCc1ccc(OCCOc2ccccc2)nc1 |
| InChI | InChI=1S/C23H21N3O3S2/c27-21(13-18-16-31-23(26-18)20-7-4-12-30-20)24-14-17-8-9-22(25-15-17)29-11-10-28-19-5-2-1-3-6-19/h1-9,12,15-16H,10-11,13-14H2,(H,24,27) |
| InChIKey | GRLCTCYMDZVZSB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|