C20H22N4O4 — CID 87026592
3-(3-methyl-1,2,4-oxadiazol-5-yl)-N-[[6-(2-phenoxyethoxy)-3-pyridinyl]methyl]propanamide (PubChem CID 87026592) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is 3-(3-methyl-1,2,4-oxadiazol-5-yl)-N-[[6-(2-phenoxyethoxy)-3-pyridinyl]methyl]propanamide.
| Compound Name | 3-(3-methyl-1,2,4-oxadiazol-5-yl)-N-[[6-(2-phenoxyethoxy)-3-pyridinyl]methyl]propanamide |
|---|---|
| PubChem CID | 87026592 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 3-(3-methyl-1,2,4-oxadiazol-5-yl)-N-[[6-(2-phenoxyethoxy)-3-pyridinyl]methyl]propanamide |
| SMILES | Cc1noc(CCC(=O)NCc2ccc(OCCOc3ccccc3)nc2)n1 |
| InChI | InChI=1S/C20H22N4O4/c1-15-23-20(28-24-15)10-8-18(25)21-13-16-7-9-19(22-14-16)27-12-11-26-17-5-3-2-4-6-17/h2-7,9,14H,8,10-13H2,1H3,(H,21,25) |
| InChIKey | RTTKREFTYQFMTB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 99.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|