C19H17N3O3S — CID 60532547
2-(1,3-benzoxazol-2-ylsulfanyl)-N-[3-(3-cyanopropoxy)phenyl]acetamide (PubChem CID 60532547) has the molecular formula C19H17N3O3S and a molecular weight of 367.43 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[3-(3-cyanopropoxy)phenyl]acetamide.
| Compound Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[3-(3-cyanopropoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 60532547 |
| Molecular Formula | C19H17N3O3S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[3-(3-cyanopropoxy)phenyl]acetamide |
| SMILES | N#CCCCOc1cccc(NC(=O)CSc2nc3ccccc3o2)c1 |
| InChI | InChI=1S/C19H17N3O3S/c20-10-3-4-11-24-15-7-5-6-14(12-15)21-18(23)13-26-19-22-16-8-1-2-9-17(16)25-19/h1-2,5-9,12H,3-4,11,13H2,(H,21,23) |
| InChIKey | BDPOKVKYYVCMPP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|