C19H15BrN2O3S — CID 90576377
2-(1,3-benzoxazol-2-ylsulfanyl)-N-[4-(3-bromophenoxy)but-2-ynyl]acetamide (PubChem CID 90576377) has the molecular formula C19H15BrN2O3S and a molecular weight of 431.31 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[4-(3-bromophenoxy)but-2-ynyl]acetamide.
| Compound Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[4-(3-bromophenoxy)but-2-ynyl]acetamide |
|---|---|
| PubChem CID | 90576377 |
| Molecular Formula | C19H15BrN2O3S |
| Molecular Weight | 431.31 g/mol |
| Exact Mass | 430.00 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[4-(3-bromophenoxy)but-2-ynyl]acetamide |
| SMILES | O=C(CSc1nc2ccccc2o1)NCC#CCOc1cccc(Br)c1 |
| InChI | InChI=1S/C19H15BrN2O3S/c20-14-6-5-7-15(12-14)24-11-4-3-10-21-18(23)13-26-19-22-16-8-1-2-9-17(16)25-19/h1-2,5-9,12H,10-11,13H2,(H,21,23) |
| InChIKey | RLIVARRTFZOMCB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.31 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|