C16H16INO4S — CID 60532852
3-[(2-iodophenyl)sulfamoyl]-4-propan-2-ylbenzoic acid (PubChem CID 60532852) has the molecular formula C16H16INO4S and a molecular weight of 445.28 g/mol. Its IUPAC name is 3-[(2-iodophenyl)sulfamoyl]-4-propan-2-ylbenzoic acid.
| Compound Name | 3-[(2-iodophenyl)sulfamoyl]-4-propan-2-ylbenzoic acid |
|---|---|
| PubChem CID | 60532852 |
| Molecular Formula | C16H16INO4S |
| Molecular Weight | 445.28 g/mol |
| Exact Mass | 444.98 |
| IUPAC Name | 3-[(2-iodophenyl)sulfamoyl]-4-propan-2-ylbenzoic acid |
| SMILES | CC(C)c1ccc(C(=O)O)cc1S(=O)(=O)Nc1ccccc1I |
| InChI | InChI=1S/C16H16INO4S/c1-10(2)12-8-7-11(16(19)20)9-15(12)23(21,22)18-14-6-4-3-5-13(14)17/h3-10,18H,1-2H3,(H,19,20) |
| InChIKey | YIKJTWXXUHDCEP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.28 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|