C16H15F2NO4S — CID 60532983
3-[(2,5-difluorophenyl)sulfamoyl]-4-propan-2-ylbenzoic acid (PubChem CID 60532983) has the molecular formula C16H15F2NO4S and a molecular weight of 355.36 g/mol. Its IUPAC name is 3-[(2,5-difluorophenyl)sulfamoyl]-4-propan-2-ylbenzoic acid.
| Compound Name | 3-[(2,5-difluorophenyl)sulfamoyl]-4-propan-2-ylbenzoic acid |
|---|---|
| PubChem CID | 60532983 |
| Molecular Formula | C16H15F2NO4S |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 3-[(2,5-difluorophenyl)sulfamoyl]-4-propan-2-ylbenzoic acid |
| SMILES | CC(C)c1ccc(C(=O)O)cc1S(=O)(=O)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C16H15F2NO4S/c1-9(2)12-5-3-10(16(20)21)7-15(12)24(22,23)19-14-8-11(17)4-6-13(14)18/h3-9,19H,1-2H3,(H,20,21) |
| InChIKey | CUFOXRNPQDUEGI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |