C22H28N2OS — CID 60532999
N-(2-methyl-3-pyrrolidin-1-ylpropyl)-2-phenyl-2-phenylsulfanylacetamide (PubChem CID 60532999) has the molecular formula C22H28N2OS and a molecular weight of 368.55 g/mol. Its IUPAC name is N-(2-methyl-3-pyrrolidin-1-ylpropyl)-2-phenyl-2-phenylsulfanylacetamide.
| Compound Name | N-(2-methyl-3-pyrrolidin-1-ylpropyl)-2-phenyl-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 60532999 |
| Molecular Formula | C22H28N2OS |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | N-(2-methyl-3-pyrrolidin-1-ylpropyl)-2-phenyl-2-phenylsulfanylacetamide |
| SMILES | CC(CNC(=O)C(Sc1ccccc1)c1ccccc1)CN1CCCC1 |
| InChI | InChI=1S/C22H28N2OS/c1-18(17-24-14-8-9-15-24)16-23-22(25)21(19-10-4-2-5-11-19)26-20-12-6-3-7-13-20/h2-7,10-13,18,21H,8-9,14-17H2,1H3,(H,23,25) |
| InChIKey | UJHWXRPXIFNPSM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |