C18H25BrN2O2 — CID 60536010
N-[6-[2-(3-bromophenyl)pyrrolidin-1-yl]-6-oxohexyl]acetamide (PubChem CID 60536010) has the molecular formula C18H25BrN2O2 and a molecular weight of 381.31 g/mol. Its IUPAC name is N-[6-[2-(3-bromophenyl)pyrrolidin-1-yl]-6-oxohexyl]acetamide.
| Compound Name | N-[6-[2-(3-bromophenyl)pyrrolidin-1-yl]-6-oxohexyl]acetamide |
|---|---|
| PubChem CID | 60536010 |
| Molecular Formula | C18H25BrN2O2 |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | N-[6-[2-(3-bromophenyl)pyrrolidin-1-yl]-6-oxohexyl]acetamide |
| SMILES | CC(=O)NCCCCCC(=O)N1CCCC1c1cccc(Br)c1 |
| InChI | InChI=1S/C18H25BrN2O2/c1-14(22)20-11-4-2-3-10-18(23)21-12-6-9-17(21)15-7-5-8-16(19)13-15/h5,7-8,13,17H,2-4,6,9-12H2,1H3,(H,20,22) |
| InChIKey | POKOJEICVXGWBH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|