C18H23BrN2O2 — CID 52500706
N-[4-[(2R)-2-(3-bromophenyl)pyrrolidin-1-yl]-4-oxobutyl]cyclopropanecarboxamide (PubChem CID 52500706) has the molecular formula C18H23BrN2O2 and a molecular weight of 379.30 g/mol. Its IUPAC name is N-[4-[(2R)-2-(3-bromophenyl)pyrrolidin-1-yl]-4-oxobutyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[(2R)-2-(3-bromophenyl)pyrrolidin-1-yl]-4-oxobutyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 52500706 |
| Molecular Formula | C18H23BrN2O2 |
| Molecular Weight | 379.30 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | N-[4-[(2R)-2-(3-bromophenyl)pyrrolidin-1-yl]-4-oxobutyl]cyclopropanecarboxamide |
| SMILES | O=C(NCCCC(=O)N1CCC[C@@H]1c1cccc(Br)c1)C1CC1 |
| InChI | InChI=1S/C18H23BrN2O2/c19-15-5-1-4-14(12-15)16-6-3-11-21(16)17(22)7-2-10-20-18(23)13-8-9-13/h1,4-5,12-13,16H,2-3,6-11H2,(H,20,23)/t16-/m1/s1 |
| InChIKey | ZMXHCKLMRLRMKD-MRXNPFEDSA-N |
| XLogP | 3.42 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.30 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|