C14H19BrN2O2 — CID 79473592
2-(2-aminoethoxy)-1-[2-(3-bromophenyl)pyrrolidin-1-yl]ethanone (PubChem CID 79473592) has the molecular formula C14H19BrN2O2 and a molecular weight of 327.22 g/mol. Its IUPAC name is 2-(2-aminoethoxy)-1-[2-(3-bromophenyl)pyrrolidin-1-yl]ethanone.
| Compound Name | 2-(2-aminoethoxy)-1-[2-(3-bromophenyl)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 79473592 |
| Molecular Formula | C14H19BrN2O2 |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 2-(2-aminoethoxy)-1-[2-(3-bromophenyl)pyrrolidin-1-yl]ethanone |
| SMILES | NCCOCC(=O)N1CCCC1c1cccc(Br)c1 |
| InChI | InChI=1S/C14H19BrN2O2/c15-12-4-1-3-11(9-12)13-5-2-7-17(13)14(18)10-19-8-6-16/h1,3-4,9,13H,2,5-8,10,16H2 |
| InChIKey | GWDWQDXKZJZHGP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|