C19H20N2O5 — CID 60538641
methyl 2-[3-methyl-4-[2-(2-oxo-1,3-benzoxazol-3-yl)ethylamino]phenoxy]acetate (PubChem CID 60538641) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is methyl 2-[3-methyl-4-[2-(2-oxo-1,3-benzoxazol-3-yl)ethylamino]phenoxy]acetate.
| Compound Name | methyl 2-[3-methyl-4-[2-(2-oxo-1,3-benzoxazol-3-yl)ethylamino]phenoxy]acetate |
|---|---|
| PubChem CID | 60538641 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | methyl 2-[3-methyl-4-[2-(2-oxo-1,3-benzoxazol-3-yl)ethylamino]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(NCCn2c(=O)oc3ccccc32)c(C)c1 |
| InChI | InChI=1S/C19H20N2O5/c1-13-11-14(25-12-18(22)24-2)7-8-15(13)20-9-10-21-16-5-3-4-6-17(16)26-19(21)23/h3-8,11,20H,9-10,12H2,1-2H3 |
| InChIKey | NCECFAGZPIMSKL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|