About 2-(3-methylbutoxy)ethyl 6-propan-2-yloxypyridine-3-carboxylate
2-(3-methylbutoxy)ethyl 6-propan-2-yloxypyridine-3-carboxylate (PubChem CID 60541445) has the molecular formula C16H25NO4
and a molecular weight of 295.38 g/mol. Its IUPAC name is 2-(3-methylbutoxy)ethyl 6-propan-2-yloxypyridine-3-carboxylate.
Molecular Properties
| Compound Name | 2-(3-methylbutoxy)ethyl 6-propan-2-yloxypyridine-3-carboxylate |
| PubChem CID | 60541445 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 2-(3-methylbutoxy)ethyl 6-propan-2-yloxypyridine-3-carboxylate |
| SMILES | CC(C)CCOCCOC(=O)c1ccc(OC(C)C)nc1 |
| InChI | InChI=1S/C16H25NO4/c1-12(2)7-8-19-9-10-20-16(18)14-5-6-15(17-11-14)21-13(3)4/h5-6,11-13H,7-10H2,1-4H3 |
| InChIKey | YRPNPPYKNDLWJZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-methylbutoxy)ethyl 6-propan-2-yloxypyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methylbutoxy)ethyl 6-propan-2-yloxypyridine-3-carboxylate?
The IUPAC name of 2-(3-methylbutoxy)ethyl 6-propan-2-yloxypyridine-3-carboxylate (CID 60541445) is 2-(3-methylbutoxy)ethyl 6-propan-2-yloxypyridine-3-carboxylate.
What is the SMILES notation for 2-(3-methylbutoxy)ethyl 6-propan-2-yloxypyridine-3-carboxylate?
The canonical SMILES for 2-(3-methylbutoxy)ethyl 6-propan-2-yloxypyridine-3-carboxylate is CC(C)CCOCCOC(=O)c1ccc(OC(C)C)nc1.
What is the InChIKey of 2-(3-methylbutoxy)ethyl 6-propan-2-yloxypyridine-3-carboxylate?
The InChIKey is YRPNPPYKNDLWJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO4/c1-12(2)7-8-19-9-10-20-16(18)14-5-6-15(17-11-14)21-13(3)4/h5-6,11-13H,7-10H2,1-4H3.
What are the key properties of 2-(3-methylbutoxy)ethyl 6-propan-2-yloxypyridine-3-carboxylate?
2-(3-methylbutoxy)ethyl 6-propan-2-yloxypyridine-3-carboxylate has a molecular weight of 295.38 g/mol, XLogP of 3.09, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methylbutoxy)ethyl 6-propan-2-yloxypyridine-3-carboxylate is sourced from PubChem (CID 60541445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).