C19H20BrN3O3S — CID 60542624
N-(5-bromo-2-pyridinyl)-1-[(E)-2-phenylethenyl]sulfonylpiperidine-3-carboxamide (PubChem CID 60542624) has the molecular formula C19H20BrN3O3S and a molecular weight of 450.36 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)-1-[(E)-2-phenylethenyl]sulfonylpiperidine-3-carboxamide.
| Compound Name | N-(5-bromo-2-pyridinyl)-1-[(E)-2-phenylethenyl]sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 60542624 |
| Molecular Formula | C19H20BrN3O3S |
| Molecular Weight | 450.36 g/mol |
| Exact Mass | 449.04 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)-1-[(E)-2-phenylethenyl]sulfonylpiperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Br)cn1)C1CCCN(S(=O)(=O)/C=C/c2ccccc2)C1 |
| InChI | InChI=1S/C19H20BrN3O3S/c20-17-8-9-18(21-13-17)22-19(24)16-7-4-11-23(14-16)27(25,26)12-10-15-5-2-1-3-6-15/h1-3,5-6,8-10,12-13,16H,4,7,11,14H2,(H,21,22,24)/b12-10+ |
| InChIKey | WHTMVWWIELCVPI-ZRDIBKRKSA-N |
| XLogP | 3.50 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |