C17H16BrF2N3O3S — CID 55815983
N-(5-bromo-2-pyridinyl)-1-(2,5-difluorophenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 55815983) has the molecular formula C17H16BrF2N3O3S and a molecular weight of 460.30 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)-1-(2,5-difluorophenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | N-(5-bromo-2-pyridinyl)-1-(2,5-difluorophenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 55815983 |
| Molecular Formula | C17H16BrF2N3O3S |
| Molecular Weight | 460.30 g/mol |
| Exact Mass | 459.01 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)-1-(2,5-difluorophenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Br)cn1)C1CCCN(S(=O)(=O)c2cc(F)ccc2F)C1 |
| InChI | InChI=1S/C17H16BrF2N3O3S/c18-12-3-6-16(21-9-12)22-17(24)11-2-1-7-23(10-11)27(25,26)15-8-13(19)4-5-14(15)20/h3-6,8-9,11H,1-2,7,10H2,(H,21,22,24) |
| InChIKey | PQKMXXKIMLPLID-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |