About (4-acetamidophenyl) 2-(3-bromo-2-methylindol-1-yl)acetate
(4-acetamidophenyl) 2-(3-bromo-2-methylindol-1-yl)acetate (PubChem CID 60551156) has the molecular formula C19H17BrN2O3
and a molecular weight of 401.26 g/mol. Its IUPAC name is (4-acetamidophenyl) 2-(3-bromo-2-methylindol-1-yl)acetate.
Molecular Properties
| Compound Name | (4-acetamidophenyl) 2-(3-bromo-2-methylindol-1-yl)acetate |
| PubChem CID | 60551156 |
| Molecular Formula | C19H17BrN2O3 |
| Molecular Weight | 401.26 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | (4-acetamidophenyl) 2-(3-bromo-2-methylindol-1-yl)acetate |
| SMILES | CC(=O)Nc1ccc(OC(=O)Cn2c(C)c(Br)c3ccccc32)cc1 |
| InChI | InChI=1S/C19H17BrN2O3/c1-12-19(20)16-5-3-4-6-17(16)22(12)11-18(24)25-15-9-7-14(8-10-15)21-13(2)23/h3-10H,11H2,1-2H3,(H,21,23) |
| InChIKey | OUBPQKKPKVDBRW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.26 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-acetamidophenyl) 2-(3-bromo-2-methylindol-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-acetamidophenyl) 2-(3-bromo-2-methylindol-1-yl)acetate?
The IUPAC name of (4-acetamidophenyl) 2-(3-bromo-2-methylindol-1-yl)acetate (CID 60551156) is (4-acetamidophenyl) 2-(3-bromo-2-methylindol-1-yl)acetate.
What is the SMILES notation for (4-acetamidophenyl) 2-(3-bromo-2-methylindol-1-yl)acetate?
The canonical SMILES for (4-acetamidophenyl) 2-(3-bromo-2-methylindol-1-yl)acetate is CC(=O)Nc1ccc(OC(=O)Cn2c(C)c(Br)c3ccccc32)cc1.
What is the InChIKey of (4-acetamidophenyl) 2-(3-bromo-2-methylindol-1-yl)acetate?
The InChIKey is OUBPQKKPKVDBRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17BrN2O3/c1-12-19(20)16-5-3-4-6-17(16)22(12)11-18(24)25-15-9-7-14(8-10-15)21-13(2)23/h3-10H,11H2,1-2H3,(H,21,23).
What are the key properties of (4-acetamidophenyl) 2-(3-bromo-2-methylindol-1-yl)acetate?
(4-acetamidophenyl) 2-(3-bromo-2-methylindol-1-yl)acetate has a molecular weight of 401.26 g/mol, XLogP of 4.28, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-acetamidophenyl) 2-(3-bromo-2-methylindol-1-yl)acetate is sourced from PubChem (CID 60551156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).