C15H23N5O3S — CID 60552393
1-ethyl-N-[3-[ethyl(methylsulfonyl)amino]propyl]benzotriazole-5-carboxamide (PubChem CID 60552393) has the molecular formula C15H23N5O3S and a molecular weight of 353.45 g/mol. Its IUPAC name is 1-ethyl-N-[3-[ethyl(methylsulfonyl)amino]propyl]benzotriazole-5-carboxamide.
| Compound Name | 1-ethyl-N-[3-[ethyl(methylsulfonyl)amino]propyl]benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 60552393 |
| Molecular Formula | C15H23N5O3S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 1-ethyl-N-[3-[ethyl(methylsulfonyl)amino]propyl]benzotriazole-5-carboxamide |
| SMILES | CCN(CCCNC(=O)c1ccc2c(c1)nnn2CC)S(C)(=O)=O |
| InChI | InChI=1S/C15H23N5O3S/c1-4-19(24(3,22)23)10-6-9-16-15(21)12-7-8-14-13(11-12)17-18-20(14)5-2/h7-8,11H,4-6,9-10H2,1-3H3,(H,16,21) |
| InChIKey | WEJXLWOGZRSQAM-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|