C20H25N5O — CID 60566120
1-ethyl-N-[4-(N-methylanilino)butyl]benzotriazole-5-carboxamide (PubChem CID 60566120) has the molecular formula C20H25N5O and a molecular weight of 351.45 g/mol. Its IUPAC name is 1-ethyl-N-[4-(N-methylanilino)butyl]benzotriazole-5-carboxamide.
| Compound Name | 1-ethyl-N-[4-(N-methylanilino)butyl]benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 60566120 |
| Molecular Formula | C20H25N5O |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | 1-ethyl-N-[4-(N-methylanilino)butyl]benzotriazole-5-carboxamide |
| SMILES | CCn1nnc2cc(C(=O)NCCCCN(C)c3ccccc3)ccc21 |
| InChI | InChI=1S/C20H25N5O/c1-3-25-19-12-11-16(15-18(19)22-23-25)20(26)21-13-7-8-14-24(2)17-9-5-4-6-10-17/h4-6,9-12,15H,3,7-8,13-14H2,1-2H3,(H,21,26) |
| InChIKey | KIYADHBSJPIPAA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|