C17H18N6O3 — CID 9278775
1-ethyl-N-[2-(2-nitroanilino)ethyl]benzotriazole-5-carboxamide (PubChem CID 9278775) has the molecular formula C17H18N6O3 and a molecular weight of 354.37 g/mol. Its IUPAC name is 1-ethyl-N-[2-(2-nitroanilino)ethyl]benzotriazole-5-carboxamide.
| Compound Name | 1-ethyl-N-[2-(2-nitroanilino)ethyl]benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 9278775 |
| Molecular Formula | C17H18N6O3 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 1-ethyl-N-[2-(2-nitroanilino)ethyl]benzotriazole-5-carboxamide |
| SMILES | CCn1nnc2cc(C(=O)NCCNc3ccccc3[N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C17H18N6O3/c1-2-22-15-8-7-12(11-14(15)20-21-22)17(24)19-10-9-18-13-5-3-4-6-16(13)23(25)26/h3-8,11,18H,2,9-10H2,1H3,(H,19,24) |
| InChIKey | KRLVMBYMSWCQOV-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|