C9H15F3N2O4S — CID 60562502
N-pyrrolidin-1-ylsulfonyl-3-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 60562502) has the molecular formula C9H15F3N2O4S and a molecular weight of 304.29 g/mol. Its IUPAC name is N-pyrrolidin-1-ylsulfonyl-3-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-pyrrolidin-1-ylsulfonyl-3-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 60562502 |
| Molecular Formula | C9H15F3N2O4S |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | N-pyrrolidin-1-ylsulfonyl-3-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | O=C(CCOCC(F)(F)F)NS(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C9H15F3N2O4S/c10-9(11,12)7-18-6-3-8(15)13-19(16,17)14-4-1-2-5-14/h1-7H2,(H,13,15) |
| InChIKey | LSTFWOXYVYXSEC-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|