C19H19N3OS2 — CID 60563556
6-(cyclopropylamino)-N,N-bis(thiophen-2-ylmethyl)pyridine-3-carboxamide (PubChem CID 60563556) has the molecular formula C19H19N3OS2 and a molecular weight of 369.52 g/mol. Its IUPAC name is 6-(cyclopropylamino)-N,N-bis(thiophen-2-ylmethyl)pyridine-3-carboxamide.
| Compound Name | 6-(cyclopropylamino)-N,N-bis(thiophen-2-ylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 60563556 |
| Molecular Formula | C19H19N3OS2 |
| Molecular Weight | 369.52 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 6-(cyclopropylamino)-N,N-bis(thiophen-2-ylmethyl)pyridine-3-carboxamide |
| SMILES | O=C(c1ccc(NC2CC2)nc1)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C19H19N3OS2/c23-19(14-5-8-18(20-11-14)21-15-6-7-15)22(12-16-3-1-9-24-16)13-17-4-2-10-25-17/h1-5,8-11,15H,6-7,12-13H2,(H,20,21) |
| InChIKey | SQFYSBXHRAKCJL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.52 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |