C17H25FN2O4S — CID 60563649
tert-butyl 4-[(4-fluoro-2-methylphenyl)sulfonylamino]piperidine-1-carboxylate (PubChem CID 60563649) has the molecular formula C17H25FN2O4S and a molecular weight of 372.46 g/mol. Its IUPAC name is tert-butyl 4-[(4-fluoro-2-methylphenyl)sulfonylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-fluoro-2-methylphenyl)sulfonylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 60563649 |
| Molecular Formula | C17H25FN2O4S |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | tert-butyl 4-[(4-fluoro-2-methylphenyl)sulfonylamino]piperidine-1-carboxylate |
| SMILES | Cc1cc(F)ccc1S(=O)(=O)NC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C17H25FN2O4S/c1-12-11-13(18)5-6-15(12)25(22,23)19-14-7-9-20(10-8-14)16(21)24-17(2,3)4/h5-6,11,14,19H,7-10H2,1-4H3 |
| InChIKey | ATYFOCRICQKXCR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |