C17H12ClN3O3S2 — CID 60563885
N-(4-chloro-3-nitrophenyl)-2-phenyl-2-(1,3-thiazol-2-ylsulfanyl)acetamide (PubChem CID 60563885) has the molecular formula C17H12ClN3O3S2 and a molecular weight of 405.89 g/mol. Its IUPAC name is N-(4-chloro-3-nitrophenyl)-2-phenyl-2-(1,3-thiazol-2-ylsulfanyl)acetamide.
| Compound Name | N-(4-chloro-3-nitrophenyl)-2-phenyl-2-(1,3-thiazol-2-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 60563885 |
| Molecular Formula | C17H12ClN3O3S2 |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.00 |
| IUPAC Name | N-(4-chloro-3-nitrophenyl)-2-phenyl-2-(1,3-thiazol-2-ylsulfanyl)acetamide |
| SMILES | O=C(Nc1ccc(Cl)c([N+](=O)[O-])c1)C(Sc1nccs1)c1ccccc1 |
| InChI | InChI=1S/C17H12ClN3O3S2/c18-13-7-6-12(10-14(13)21(23)24)20-16(22)15(11-4-2-1-3-5-11)26-17-19-8-9-25-17/h1-10,15H,(H,20,22) |
| InChIKey | WDMZBCKYJPDPAU-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|