C11H12N4O3S — CID 60564184
methyl 5-[(1-prop-2-enyltetrazol-5-yl)sulfanylmethyl]furan-2-carboxylate (PubChem CID 60564184) has the molecular formula C11H12N4O3S and a molecular weight of 280.31 g/mol. Its IUPAC name is methyl 5-[(1-prop-2-enyltetrazol-5-yl)sulfanylmethyl]furan-2-carboxylate.
| Compound Name | methyl 5-[(1-prop-2-enyltetrazol-5-yl)sulfanylmethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 60564184 |
| Molecular Formula | C11H12N4O3S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | methyl 5-[(1-prop-2-enyltetrazol-5-yl)sulfanylmethyl]furan-2-carboxylate |
| SMILES | C=CCn1nnnc1SCc1ccc(C(=O)OC)o1 |
| InChI | InChI=1S/C11H12N4O3S/c1-3-6-15-11(12-13-14-15)19-7-8-4-5-9(18-8)10(16)17-2/h3-5H,1,6-7H2,2H3 |
| InChIKey | LOCZYYUPVCQVGH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 83.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|