C14H20N2O4S — CID 60565196
3-methoxy-4-methyl-N-piperidin-1-ylsulfonylbenzamide (PubChem CID 60565196) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is 3-methoxy-4-methyl-N-piperidin-1-ylsulfonylbenzamide.
| Compound Name | 3-methoxy-4-methyl-N-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 60565196 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 3-methoxy-4-methyl-N-piperidin-1-ylsulfonylbenzamide |
| SMILES | COc1cc(C(=O)NS(=O)(=O)N2CCCCC2)ccc1C |
| InChI | InChI=1S/C14H20N2O4S/c1-11-6-7-12(10-13(11)20-2)14(17)15-21(18,19)16-8-4-3-5-9-16/h6-7,10H,3-5,8-9H2,1-2H3,(H,15,17) |
| InChIKey | MVOJAIZIVGXKBN-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |