C16H25N5O3 — CID 60568087
1-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-3-(4-nitrophenyl)urea (PubChem CID 60568087) has the molecular formula C16H25N5O3 and a molecular weight of 335.41 g/mol. Its IUPAC name is 1-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-3-(4-nitrophenyl)urea.
| Compound Name | 1-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 60568087 |
| Molecular Formula | C16H25N5O3 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 1-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-3-(4-nitrophenyl)urea |
| SMILES | CC(CNC(=O)Nc1ccc([N+](=O)[O-])cc1)CN1CCN(C)CC1 |
| InChI | InChI=1S/C16H25N5O3/c1-13(12-20-9-7-19(2)8-10-20)11-17-16(22)18-14-3-5-15(6-4-14)21(23)24/h3-6,13H,7-12H2,1-2H3,(H2,17,18,22) |
| InChIKey | DHLGZDLITRZEAD-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 90.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|