C19H22FNO4 — CID 60571717
N-[2-(4-fluorophenyl)ethyl]-2,3,4-trimethoxy-N-methylbenzamide (PubChem CID 60571717) has the molecular formula C19H22FNO4 and a molecular weight of 347.39 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-2,3,4-trimethoxy-N-methylbenzamide.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-2,3,4-trimethoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 60571717 |
| Molecular Formula | C19H22FNO4 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-2,3,4-trimethoxy-N-methylbenzamide |
| SMILES | COc1ccc(C(=O)N(C)CCc2ccc(F)cc2)c(OC)c1OC |
| InChI | InChI=1S/C19H22FNO4/c1-21(12-11-13-5-7-14(20)8-6-13)19(22)15-9-10-16(23-2)18(25-4)17(15)24-3/h5-10H,11-12H2,1-4H3 |
| InChIKey | PVRNWYZQAUCRPH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |