C23H29BrN2O4 — CID 60572748
2-[[4-(3-bromophenyl)oxan-4-yl]amino]-N-[2-(4-ethoxyphenoxy)ethyl]acetamide (PubChem CID 60572748) has the molecular formula C23H29BrN2O4 and a molecular weight of 477.40 g/mol. Its IUPAC name is 2-[[4-(3-bromophenyl)oxan-4-yl]amino]-N-[2-(4-ethoxyphenoxy)ethyl]acetamide.
| Compound Name | 2-[[4-(3-bromophenyl)oxan-4-yl]amino]-N-[2-(4-ethoxyphenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 60572748 |
| Molecular Formula | C23H29BrN2O4 |
| Molecular Weight | 477.40 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 2-[[4-(3-bromophenyl)oxan-4-yl]amino]-N-[2-(4-ethoxyphenoxy)ethyl]acetamide |
| SMILES | CCOc1ccc(OCCNC(=O)CNC2(c3cccc(Br)c3)CCOCC2)cc1 |
| InChI | InChI=1S/C23H29BrN2O4/c1-2-29-20-6-8-21(9-7-20)30-15-12-25-22(27)17-26-23(10-13-28-14-11-23)18-4-3-5-19(24)16-18/h3-9,16,26H,2,10-15,17H2,1H3,(H,25,27) |
| InChIKey | GPRXOSOPDWPPAY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|