C25H25BrN2O2 — CID 60572851
4-[[[4-(3-bromophenyl)oxan-4-yl]amino]methyl]-N-phenylbenzamide (PubChem CID 60572851) has the molecular formula C25H25BrN2O2 and a molecular weight of 465.39 g/mol. Its IUPAC name is 4-[[[4-(3-bromophenyl)oxan-4-yl]amino]methyl]-N-phenylbenzamide.
| Compound Name | 4-[[[4-(3-bromophenyl)oxan-4-yl]amino]methyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 60572851 |
| Molecular Formula | C25H25BrN2O2 |
| Molecular Weight | 465.39 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 4-[[[4-(3-bromophenyl)oxan-4-yl]amino]methyl]-N-phenylbenzamide |
| SMILES | O=C(Nc1ccccc1)c1ccc(CNC2(c3cccc(Br)c3)CCOCC2)cc1 |
| InChI | InChI=1S/C25H25BrN2O2/c26-22-6-4-5-21(17-22)25(13-15-30-16-14-25)27-18-19-9-11-20(12-10-19)24(29)28-23-7-2-1-3-8-23/h1-12,17,27H,13-16,18H2,(H,28,29) |
| InChIKey | ZSDUVKPWHAYCMF-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.39 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |