C21H24ClN3O3 — CID 60573055
4-chloro-N-[4-[(4-hydroxycyclohexyl)carbamoylamino]phenyl]-N-methylbenzamide (PubChem CID 60573055) has the molecular formula C21H24ClN3O3 and a molecular weight of 401.89 g/mol. Its IUPAC name is 4-chloro-N-[4-[(4-hydroxycyclohexyl)carbamoylamino]phenyl]-N-methylbenzamide.
| Compound Name | 4-chloro-N-[4-[(4-hydroxycyclohexyl)carbamoylamino]phenyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 60573055 |
| Molecular Formula | C21H24ClN3O3 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 4-chloro-N-[4-[(4-hydroxycyclohexyl)carbamoylamino]phenyl]-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccc(Cl)cc1)c1ccc(NC(=O)NC2CCC(O)CC2)cc1 |
| InChI | InChI=1S/C21H24ClN3O3/c1-25(20(27)14-2-4-15(22)5-3-14)18-10-6-16(7-11-18)23-21(28)24-17-8-12-19(26)13-9-17/h2-7,10-11,17,19,26H,8-9,12-13H2,1H3,(H2,23,24,28) |
| InChIKey | SJSJQOAOSXFVCP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |