C19H17Cl2N3O6 — CID 60573341
N-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-3,5-dinitrobenzamide (PubChem CID 60573341) has the molecular formula C19H17Cl2N3O6 and a molecular weight of 454.27 g/mol. Its IUPAC name is N-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-3,5-dinitrobenzamide.
| Compound Name | N-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 60573341 |
| Molecular Formula | C19H17Cl2N3O6 |
| Molecular Weight | 454.27 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | N-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-3,5-dinitrobenzamide |
| SMILES | O=C(NCC1(c2ccc(Cl)cc2Cl)CCOCC1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H17Cl2N3O6/c20-13-1-2-16(17(21)9-13)19(3-5-30-6-4-19)11-22-18(25)12-7-14(23(26)27)10-15(8-12)24(28)29/h1-2,7-10H,3-6,11H2,(H,22,25) |
| InChIKey | WVJAFDVREITRAN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.27 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|