C15H20Cl2N2O3 — CID 110904192
1-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-3-(2-hydroxyethyl)urea (PubChem CID 110904192) has the molecular formula C15H20Cl2N2O3 and a molecular weight of 347.24 g/mol. Its IUPAC name is 1-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-3-(2-hydroxyethyl)urea.
| Compound Name | 1-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-3-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 110904192 |
| Molecular Formula | C15H20Cl2N2O3 |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 1-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-3-(2-hydroxyethyl)urea |
| SMILES | O=C(NCCO)NCC1(c2ccc(Cl)cc2Cl)CCOCC1 |
| InChI | InChI=1S/C15H20Cl2N2O3/c16-11-1-2-12(13(17)9-11)15(3-7-22-8-4-15)10-19-14(21)18-5-6-20/h1-2,9,20H,3-8,10H2,(H2,18,19,21) |
| InChIKey | DYFSQYBMKRNLAG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |