C18H24Cl2N2O3 — CID 86833800
N-[2-[[4-(2,4-dichlorophenyl)oxan-4-yl]methylamino]-2-oxoethyl]butanamide (PubChem CID 86833800) has the molecular formula C18H24Cl2N2O3 and a molecular weight of 387.31 g/mol. Its IUPAC name is N-[2-[[4-(2,4-dichlorophenyl)oxan-4-yl]methylamino]-2-oxoethyl]butanamide.
| Compound Name | N-[2-[[4-(2,4-dichlorophenyl)oxan-4-yl]methylamino]-2-oxoethyl]butanamide |
|---|---|
| PubChem CID | 86833800 |
| Molecular Formula | C18H24Cl2N2O3 |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | N-[2-[[4-(2,4-dichlorophenyl)oxan-4-yl]methylamino]-2-oxoethyl]butanamide |
| SMILES | CCCC(=O)NCC(=O)NCC1(c2ccc(Cl)cc2Cl)CCOCC1 |
| InChI | InChI=1S/C18H24Cl2N2O3/c1-2-3-16(23)21-11-17(24)22-12-18(6-8-25-9-7-18)14-5-4-13(19)10-15(14)20/h4-5,10H,2-3,6-9,11-12H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | YQRUAQIFLAUUOB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |