C17H11ClN4O3S — CID 60576198
(E)-N-[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 60576198) has the molecular formula C17H11ClN4O3S and a molecular weight of 386.82 g/mol. Its IUPAC name is (E)-N-[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 60576198 |
| Molecular Formula | C17H11ClN4O3S |
| Molecular Weight | 386.82 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | (E)-N-[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc([N+](=O)[O-])c1)Nc1nnc(-c2ccccc2Cl)s1 |
| InChI | InChI=1S/C17H11ClN4O3S/c18-14-7-2-1-6-13(14)16-20-21-17(26-16)19-15(23)9-8-11-4-3-5-12(10-11)22(24)25/h1-10H,(H,19,21,23)/b9-8+ |
| InChIKey | NIGGWKSOGIVPCL-CMDGGOBGSA-N |
| XLogP | 4.42 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.82 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|