C20H24F2N2O3S — CID 60576277
3-[4-(diethylsulfamoyl)phenyl]-N-(3,4-difluorophenyl)-N-methylpropanamide (PubChem CID 60576277) has the molecular formula C20H24F2N2O3S and a molecular weight of 410.49 g/mol. Its IUPAC name is 3-[4-(diethylsulfamoyl)phenyl]-N-(3,4-difluorophenyl)-N-methylpropanamide.
| Compound Name | 3-[4-(diethylsulfamoyl)phenyl]-N-(3,4-difluorophenyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 60576277 |
| Molecular Formula | C20H24F2N2O3S |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 3-[4-(diethylsulfamoyl)phenyl]-N-(3,4-difluorophenyl)-N-methylpropanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CCC(=O)N(C)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C20H24F2N2O3S/c1-4-24(5-2)28(26,27)17-10-6-15(7-11-17)8-13-20(25)23(3)16-9-12-18(21)19(22)14-16/h6-7,9-12,14H,4-5,8,13H2,1-3H3 |
| InChIKey | ZIDQEIAMBLZZID-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |