C15H17FN2O3 — CID 60579306
6-fluoro-N-[(3,4,5-trimethoxyphenyl)methyl]pyridin-2-amine (PubChem CID 60579306) has the molecular formula C15H17FN2O3 and a molecular weight of 292.31 g/mol. Its IUPAC name is 6-fluoro-N-[(3,4,5-trimethoxyphenyl)methyl]pyridin-2-amine.
| Compound Name | 6-fluoro-N-[(3,4,5-trimethoxyphenyl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 60579306 |
| Molecular Formula | C15H17FN2O3 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 6-fluoro-N-[(3,4,5-trimethoxyphenyl)methyl]pyridin-2-amine |
| SMILES | COc1cc(CNc2cccc(F)n2)cc(OC)c1OC |
| InChI | InChI=1S/C15H17FN2O3/c1-19-11-7-10(8-12(20-2)15(11)21-3)9-17-14-6-4-5-13(16)18-14/h4-8H,9H2,1-3H3,(H,17,18) |
| InChIKey | RTCNQOZNDWMKST-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|